C16H23N3O5S — CID 7286174
N-(2-hydroxyethyl)-N'-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]oxamide (PubChem CID 7286174) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N'-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]oxamide.
| Compound Name | N-(2-hydroxyethyl)-N'-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 7286174 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N-(2-hydroxyethyl)-N'-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]oxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H]2CNC(=O)C(=O)NCCO)cc1 |
| InChI | InChI=1S/C16H23N3O5S/c1-12-4-6-14(7-5-12)25(23,24)19-9-2-3-13(19)11-18-16(22)15(21)17-8-10-20/h4-7,13,20H,2-3,8-11H2,1H3,(H,17,21)(H,18,22)/t13-/m0/s1 |
| InChIKey | SOAXTWRXRJJMDN-ZDUSSCGKSA-N |
| XLogP | -0.63 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|