C17H21N3O2 — CID 72861872
N-(cyclohexylmethyl)-2-(5-oxo-1,6-naphthyridin-6-yl)acetamide (PubChem CID 72861872) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-(5-oxo-1,6-naphthyridin-6-yl)acetamide.
| Compound Name | N-(cyclohexylmethyl)-2-(5-oxo-1,6-naphthyridin-6-yl)acetamide |
|---|---|
| PubChem CID | 72861872 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-(cyclohexylmethyl)-2-(5-oxo-1,6-naphthyridin-6-yl)acetamide |
| SMILES | O=C(Cn1ccc2ncccc2c1=O)NCC1CCCCC1 |
| InChI | InChI=1S/C17H21N3O2/c21-16(19-11-13-5-2-1-3-6-13)12-20-10-8-15-14(17(20)22)7-4-9-18-15/h4,7-10,13H,1-3,5-6,11-12H2,(H,19,21) |
| InChIKey | WXBLKUGZEXAYSJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |