C15H19N5O2S — CID 72862125
9-(1,3-dimethylpyrazolo[5,4-d][1,3]thiazol-5-yl)-3,9-diazaspiro[5.5]undecane-2,4-dione (PubChem CID 72862125) has the molecular formula C15H19N5O2S and a molecular weight of 333.42 g/mol. Its IUPAC name is 9-(1,3-dimethylpyrazolo[5,4-d][1,3]thiazol-5-yl)-3,9-diazaspiro[5.5]undecane-2,4-dione.
| Compound Name | 9-(1,3-dimethylpyrazolo[5,4-d][1,3]thiazol-5-yl)-3,9-diazaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 72862125 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 9-(1,3-dimethylpyrazolo[5,4-d][1,3]thiazol-5-yl)-3,9-diazaspiro[5.5]undecane-2,4-dione |
| SMILES | Cc1nn(C)c2nc(N3CCC4(CC3)CC(=O)NC(=O)C4)sc12 |
| InChI | InChI=1S/C15H19N5O2S/c1-9-12-13(19(2)18-9)17-14(23-12)20-5-3-15(4-6-20)7-10(21)16-11(22)8-15/h3-8H2,1-2H3,(H,16,21,22) |
| InChIKey | BCOJNTIVDIFJHJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|