About 3-[(3R,4S)-1-(2-amino-7H-purin-6-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid
3-[(3R,4S)-1-(2-amino-7H-purin-6-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid (PubChem CID 72862681) has the molecular formula C17H25N7O3
and a molecular weight of 375.43 g/mol. Its IUPAC name is 3-[(3R,4S)-1-(2-amino-7H-purin-6-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[(3R,4S)-1-(2-amino-7H-purin-6-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid |
| PubChem CID | 72862681 |
| Molecular Formula | C17H25N7O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 3-[(3R,4S)-1-(2-amino-7H-purin-6-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid |
| SMILES | Nc1nc(N2CC[C@H](N3CCOCC3)[C@H](CCC(=O)O)C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C17H25N7O3/c18-17-21-15-14(19-10-20-15)16(22-17)24-4-3-12(23-5-7-27-8-6-23)11(9-24)1-2-13(25)26/h10-12H,1-9H2,(H,25,26)(H3,18,19,20,21,22)/t11-,12+/m1/s1 |
| InChIKey | DINJWVWSKOKLKP-NEPJUHHUSA-N |
| XLogP | 0.33 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[(3R,4S)-1-(2-amino-7H-purin-6-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R,4S)-1-(2-amino-7H-purin-6-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid?
The IUPAC name of 3-[(3R,4S)-1-(2-amino-7H-purin-6-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid (CID 72862681) is 3-[(3R,4S)-1-(2-amino-7H-purin-6-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid.
What is the SMILES notation for 3-[(3R,4S)-1-(2-amino-7H-purin-6-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid?
The canonical SMILES for 3-[(3R,4S)-1-(2-amino-7H-purin-6-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid is Nc1nc(N2CC[C@H](N3CCOCC3)[C@H](CCC(=O)O)C2)c2[nH]cnc2n1.
What is the InChIKey of 3-[(3R,4S)-1-(2-amino-7H-purin-6-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid?
The InChIKey is DINJWVWSKOKLKP-NEPJUHHUSA-N. The full InChI is InChI=1S/C17H25N7O3/c18-17-21-15-14(19-10-20-15)16(22-17)24-4-3-12(23-5-7-27-8-6-23)11(9-24)1-2-13(25)26/h10-12H,1-9H2,(H,25,26)(H3,18,19,20,21,22)/t11-,12+/m1/s1.
What are the key properties of 3-[(3R,4S)-1-(2-amino-7H-purin-6-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid?
3-[(3R,4S)-1-(2-amino-7H-purin-6-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid has a molecular weight of 375.43 g/mol, XLogP of 0.33, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R,4S)-1-(2-amino-7H-purin-6-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid is sourced from PubChem (CID 72862681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).