C13H22FN5S — CID 72863364
2-butylsulfanyl-4-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]pyrimidine-4,6-diamine (PubChem CID 72863364) has the molecular formula C13H22FN5S and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-butylsulfanyl-4-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]pyrimidine-4,6-diamine.
| Compound Name | 2-butylsulfanyl-4-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 72863364 |
| Molecular Formula | C13H22FN5S |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-butylsulfanyl-4-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]pyrimidine-4,6-diamine |
| SMILES | CCCCSc1nc(N)cc(NC[C@@H]2C[C@H](F)CN2)n1 |
| InChI | InChI=1S/C13H22FN5S/c1-2-3-4-20-13-18-11(15)6-12(19-13)17-8-10-5-9(14)7-16-10/h6,9-10,16H,2-5,7-8H2,1H3,(H3,15,17,18,19)/t9-,10-/m0/s1 |
| InChIKey | SVIIGQLITVNSAR-UWVGGRQHSA-N |
| XLogP | 2.06 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|