C16H21N3O3 — CID 72863497
N-(oxan-4-yl)-5-oxo-1-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 72863497) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-(oxan-4-yl)-5-oxo-1-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(oxan-4-yl)-5-oxo-1-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 72863497 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-(oxan-4-yl)-5-oxo-1-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCOCC1)C1CC(=O)N(Cc2cccnc2)C1 |
| InChI | InChI=1S/C16H21N3O3/c20-15-8-13(16(21)18-14-3-6-22-7-4-14)11-19(15)10-12-2-1-5-17-9-12/h1-2,5,9,13-14H,3-4,6-8,10-11H2,(H,18,21) |
| InChIKey | CHPRKHOLGHWOMC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |