C17H27N5OS — CID 72863530
N-[(3R,4S)-4-cyclopropyl-1-(3-methylsulfanylpropyl)pyrrolidin-3-yl]-2-(methylamino)pyrimidine-5-carboxamide (PubChem CID 72863530) has the molecular formula C17H27N5OS and a molecular weight of 349.50 g/mol. Its IUPAC name is N-[(3R,4S)-4-cyclopropyl-1-(3-methylsulfanylpropyl)pyrrolidin-3-yl]-2-(methylamino)pyrimidine-5-carboxamide.
| Compound Name | N-[(3R,4S)-4-cyclopropyl-1-(3-methylsulfanylpropyl)pyrrolidin-3-yl]-2-(methylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 72863530 |
| Molecular Formula | C17H27N5OS |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | N-[(3R,4S)-4-cyclopropyl-1-(3-methylsulfanylpropyl)pyrrolidin-3-yl]-2-(methylamino)pyrimidine-5-carboxamide |
| SMILES | CNc1ncc(C(=O)N[C@H]2CN(CCCSC)C[C@@H]2C2CC2)cn1 |
| InChI | InChI=1S/C17H27N5OS/c1-18-17-19-8-13(9-20-17)16(23)21-15-11-22(6-3-7-24-2)10-14(15)12-4-5-12/h8-9,12,14-15H,3-7,10-11H2,1-2H3,(H,21,23)(H,18,19,20)/t14-,15+/m1/s1 |
| InChIKey | DMJZGFCUFKPCDU-CABCVRRESA-N |
| XLogP | 1.71 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|