C20H30N4O2 — CID 72864267
[(4aS,8aS)-4a-hydroxy-7-propan-2-yl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-(2-cyclopropyl-4-methylpyrimidin-5-yl)methanone (PubChem CID 72864267) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is [(4aS,8aS)-4a-hydroxy-7-propan-2-yl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-(2-cyclopropyl-4-methylpyrimidin-5-yl)methanone.
| Compound Name | [(4aS,8aS)-4a-hydroxy-7-propan-2-yl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-(2-cyclopropyl-4-methylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 72864267 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | [(4aS,8aS)-4a-hydroxy-7-propan-2-yl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-(2-cyclopropyl-4-methylpyrimidin-5-yl)methanone |
| SMILES | Cc1nc(C2CC2)ncc1C(=O)N1CC[C@@]2(O)CCN(C(C)C)C[C@H]2C1 |
| InChI | InChI=1S/C20H30N4O2/c1-13(2)23-8-6-20(26)7-9-24(12-16(20)11-23)19(25)17-10-21-18(15-4-5-15)22-14(17)3/h10,13,15-16,26H,4-9,11-12H2,1-3H3/t16-,20-/m0/s1 |
| InChIKey | DTPWKIAEDGROLF-JXFKEZNVSA-N |
| XLogP | 1.97 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |