About 1-methyl-4-(oxan-4-yl)-1,4,10-triazaspiro[5.6]dodecan-9-one
1-methyl-4-(oxan-4-yl)-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 72864480) has the molecular formula C15H27N3O2
and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-methyl-4-(oxan-4-yl)-1,4,10-triazaspiro[5.6]dodecan-9-one.
Molecular Properties
| Compound Name | 1-methyl-4-(oxan-4-yl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
| PubChem CID | 72864480 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 1-methyl-4-(oxan-4-yl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | CN1CCN(C2CCOCC2)CC12CCNC(=O)CC2 |
| InChI | InChI=1S/C15H27N3O2/c1-17-8-9-18(13-3-10-20-11-4-13)12-15(17)5-2-14(19)16-7-6-15/h13H,2-12H2,1H3,(H,16,19) |
| InChIKey | DITYAGXWQFRSPL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-4-(oxan-4-yl)-1,4,10-triazaspiro[5.6]dodecan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-(oxan-4-yl)-1,4,10-triazaspiro[5.6]dodecan-9-one?
The IUPAC name of 1-methyl-4-(oxan-4-yl)-1,4,10-triazaspiro[5.6]dodecan-9-one (CID 72864480) is 1-methyl-4-(oxan-4-yl)-1,4,10-triazaspiro[5.6]dodecan-9-one.
What is the SMILES notation for 1-methyl-4-(oxan-4-yl)-1,4,10-triazaspiro[5.6]dodecan-9-one?
The canonical SMILES for 1-methyl-4-(oxan-4-yl)-1,4,10-triazaspiro[5.6]dodecan-9-one is CN1CCN(C2CCOCC2)CC12CCNC(=O)CC2.
What is the InChIKey of 1-methyl-4-(oxan-4-yl)-1,4,10-triazaspiro[5.6]dodecan-9-one?
The InChIKey is DITYAGXWQFRSPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O2/c1-17-8-9-18(13-3-10-20-11-4-13)12-15(17)5-2-14(19)16-7-6-15/h13H,2-12H2,1H3,(H,16,19).
What are the key properties of 1-methyl-4-(oxan-4-yl)-1,4,10-triazaspiro[5.6]dodecan-9-one?
1-methyl-4-(oxan-4-yl)-1,4,10-triazaspiro[5.6]dodecan-9-one has a molecular weight of 281.40 g/mol, XLogP of 0.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(oxan-4-yl)-1,4,10-triazaspiro[5.6]dodecan-9-one is sourced from PubChem (CID 72864480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).