C20H19F2NO4 — CID 72864656
[(3aS,9bS)-3a-(hydroxymethyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-2-yl]-(2,3-difluoro-6-methoxyphenyl)methanone (PubChem CID 72864656) has the molecular formula C20H19F2NO4 and a molecular weight of 375.37 g/mol. Its IUPAC name is [(3aS,9bS)-3a-(hydroxymethyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-2-yl]-(2,3-difluoro-6-methoxyphenyl)methanone.
| Compound Name | [(3aS,9bS)-3a-(hydroxymethyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-2-yl]-(2,3-difluoro-6-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 72864656 |
| Molecular Formula | C20H19F2NO4 |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [(3aS,9bS)-3a-(hydroxymethyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-2-yl]-(2,3-difluoro-6-methoxyphenyl)methanone |
| SMILES | COc1ccc(F)c(F)c1C(=O)N1C[C@@H]2c3ccccc3OC[C@]2(CO)C1 |
| InChI | InChI=1S/C20H19F2NO4/c1-26-16-7-6-14(21)18(22)17(16)19(25)23-8-13-12-4-2-3-5-15(12)27-11-20(13,9-23)10-24/h2-7,13,24H,8-11H2,1H3/t13-,20-/m1/s1 |
| InChIKey | GUJWITKEMNLHIQ-ZUOKHONESA-N |
| XLogP | 2.58 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |