About 8-[2-(1,2,4-triazol-4-yl)ethyl]-8-azaspiro[4.5]decane-7,9-dione
8-[2-(1,2,4-triazol-4-yl)ethyl]-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 72864747) has the molecular formula C13H18N4O2
and a molecular weight of 262.31 g/mol. Its IUPAC name is 8-[2-(1,2,4-triazol-4-yl)ethyl]-8-azaspiro[4.5]decane-7,9-dione.
Molecular Properties
| Compound Name | 8-[2-(1,2,4-triazol-4-yl)ethyl]-8-azaspiro[4.5]decane-7,9-dione |
| PubChem CID | 72864747 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 8-[2-(1,2,4-triazol-4-yl)ethyl]-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | O=C1CC2(CCCC2)CC(=O)N1CCn1cnnc1 |
| InChI | InChI=1S/C13H18N4O2/c18-11-7-13(3-1-2-4-13)8-12(19)17(11)6-5-16-9-14-15-10-16/h9-10H,1-8H2 |
| InChIKey | WNTCLOQUEZBCIR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 8-[2-(1,2,4-triazol-4-yl)ethyl]-8-azaspiro[4.5]decane-7,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[2-(1,2,4-triazol-4-yl)ethyl]-8-azaspiro[4.5]decane-7,9-dione?
The IUPAC name of 8-[2-(1,2,4-triazol-4-yl)ethyl]-8-azaspiro[4.5]decane-7,9-dione (CID 72864747) is 8-[2-(1,2,4-triazol-4-yl)ethyl]-8-azaspiro[4.5]decane-7,9-dione.
What is the SMILES notation for 8-[2-(1,2,4-triazol-4-yl)ethyl]-8-azaspiro[4.5]decane-7,9-dione?
The canonical SMILES for 8-[2-(1,2,4-triazol-4-yl)ethyl]-8-azaspiro[4.5]decane-7,9-dione is O=C1CC2(CCCC2)CC(=O)N1CCn1cnnc1.
What is the InChIKey of 8-[2-(1,2,4-triazol-4-yl)ethyl]-8-azaspiro[4.5]decane-7,9-dione?
The InChIKey is WNTCLOQUEZBCIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O2/c18-11-7-13(3-1-2-4-13)8-12(19)17(11)6-5-16-9-14-15-10-16/h9-10H,1-8H2.
What are the key properties of 8-[2-(1,2,4-triazol-4-yl)ethyl]-8-azaspiro[4.5]decane-7,9-dione?
8-[2-(1,2,4-triazol-4-yl)ethyl]-8-azaspiro[4.5]decane-7,9-dione has a molecular weight of 262.31 g/mol, XLogP of 0.99, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[2-(1,2,4-triazol-4-yl)ethyl]-8-azaspiro[4.5]decane-7,9-dione is sourced from PubChem (CID 72864747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).