C15H20FN5O2 — CID 72864778
(3aR,6aR)-5-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-2-prop-2-enyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72864778) has the molecular formula C15H20FN5O2 and a molecular weight of 321.36 g/mol. Its IUPAC name is (3aR,6aR)-5-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-2-prop-2-enyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-2-prop-2-enyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72864778 |
| Molecular Formula | C15H20FN5O2 |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (3aR,6aR)-5-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-2-prop-2-enyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | C=CCN1C[C@@H]2CN(c3ncc(F)c(NC)n3)C[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C15H20FN5O2/c1-3-4-20-6-10-7-21(9-15(10,8-20)13(22)23)14-18-5-11(16)12(17-2)19-14/h3,5,10H,1,4,6-9H2,2H3,(H,22,23)(H,17,18,19)/t10-,15-/m1/s1 |
| InChIKey | OSDKBDTYYRHXRW-MEBBXXQBSA-N |
| XLogP | 0.67 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|