About 1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-one
1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-one (PubChem CID 72865575) has the molecular formula C12H13F3N4O
and a molecular weight of 286.26 g/mol. Its IUPAC name is 1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 72865575 |
| Molecular Formula | C12H13F3N4O |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-one |
| SMILES | CC(C)n1cnnc1Cn1cccc(C(F)(F)F)c1=O |
| InChI | InChI=1S/C12H13F3N4O/c1-8(2)19-7-16-17-10(19)6-18-5-3-4-9(11(18)20)12(13,14)15/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | DHSHBHDHDBDPBW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-one (CID 72865575) is 1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-one is CC(C)n1cnnc1Cn1cccc(C(F)(F)F)c1=O.
What is the InChIKey of 1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-one?
The InChIKey is DHSHBHDHDBDPBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3N4O/c1-8(2)19-7-16-17-10(19)6-18-5-3-4-9(11(18)20)12(13,14)15/h3-5,7-8H,6H2,1-2H3.
What are the key properties of 1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-one?
1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-one has a molecular weight of 286.26 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 72865575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).