C15H20F3N7O — CID 72865756
4,4,4-trifluoro-1-[4-[4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]butan-1-one (PubChem CID 72865756) has the molecular formula C15H20F3N7O and a molecular weight of 371.37 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[4-[4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]butan-1-one.
| Compound Name | 4,4,4-trifluoro-1-[4-[4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 72865756 |
| Molecular Formula | C15H20F3N7O |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 4,4,4-trifluoro-1-[4-[4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]butan-1-one |
| SMILES | Cn1c(Cn2cncn2)nnc1C1CCN(C(=O)CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H20F3N7O/c1-23-12(8-25-10-19-9-20-25)21-22-14(23)11-3-6-24(7-4-11)13(26)2-5-15(16,17)18/h9-11H,2-8H2,1H3 |
| InChIKey | WYQZZPSLPIDAKX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |