About (3R,4S)-4-cyclopropyl-1-(2,5-dimethylthiophen-3-yl)sulfonylpyrrolidin-3-amine
(3R,4S)-4-cyclopropyl-1-(2,5-dimethylthiophen-3-yl)sulfonylpyrrolidin-3-amine (PubChem CID 72866080) has the molecular formula C13H20N2O2S2
and a molecular weight of 300.45 g/mol. Its IUPAC name is (3R,4S)-4-cyclopropyl-1-(2,5-dimethylthiophen-3-yl)sulfonylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | (3R,4S)-4-cyclopropyl-1-(2,5-dimethylthiophen-3-yl)sulfonylpyrrolidin-3-amine |
| PubChem CID | 72866080 |
| Molecular Formula | C13H20N2O2S2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (3R,4S)-4-cyclopropyl-1-(2,5-dimethylthiophen-3-yl)sulfonylpyrrolidin-3-amine |
| SMILES | Cc1cc(S(=O)(=O)N2C[C@H](C3CC3)[C@@H](N)C2)c(C)s1 |
| InChI | InChI=1S/C13H20N2O2S2/c1-8-5-13(9(2)18-8)19(16,17)15-6-11(10-3-4-10)12(14)7-15/h5,10-12H,3-4,6-7,14H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | OVYMKCWCFPTCFF-NEPJUHHUSA-N |
| XLogP | 1.72 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R,4S)-4-cyclopropyl-1-(2,5-dimethylthiophen-3-yl)sulfonylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-cyclopropyl-1-(2,5-dimethylthiophen-3-yl)sulfonylpyrrolidin-3-amine?
The IUPAC name of (3R,4S)-4-cyclopropyl-1-(2,5-dimethylthiophen-3-yl)sulfonylpyrrolidin-3-amine (CID 72866080) is (3R,4S)-4-cyclopropyl-1-(2,5-dimethylthiophen-3-yl)sulfonylpyrrolidin-3-amine.
What is the SMILES notation for (3R,4S)-4-cyclopropyl-1-(2,5-dimethylthiophen-3-yl)sulfonylpyrrolidin-3-amine?
The canonical SMILES for (3R,4S)-4-cyclopropyl-1-(2,5-dimethylthiophen-3-yl)sulfonylpyrrolidin-3-amine is Cc1cc(S(=O)(=O)N2C[C@H](C3CC3)[C@@H](N)C2)c(C)s1.
What is the InChIKey of (3R,4S)-4-cyclopropyl-1-(2,5-dimethylthiophen-3-yl)sulfonylpyrrolidin-3-amine?
The InChIKey is OVYMKCWCFPTCFF-NEPJUHHUSA-N. The full InChI is InChI=1S/C13H20N2O2S2/c1-8-5-13(9(2)18-8)19(16,17)15-6-11(10-3-4-10)12(14)7-15/h5,10-12H,3-4,6-7,14H2,1-2H3/t11-,12+/m1/s1.
What are the key properties of (3R,4S)-4-cyclopropyl-1-(2,5-dimethylthiophen-3-yl)sulfonylpyrrolidin-3-amine?
(3R,4S)-4-cyclopropyl-1-(2,5-dimethylthiophen-3-yl)sulfonylpyrrolidin-3-amine has a molecular weight of 300.45 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-cyclopropyl-1-(2,5-dimethylthiophen-3-yl)sulfonylpyrrolidin-3-amine is sourced from PubChem (CID 72866080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).