About 1-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-4-(1-methylimidazol-2-yl)triazole
1-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-4-(1-methylimidazol-2-yl)triazole (PubChem CID 72866156) has the molecular formula C15H21N7
and a molecular weight of 299.38 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-4-(1-methylimidazol-2-yl)triazole.
Molecular Properties
| Compound Name | 1-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-4-(1-methylimidazol-2-yl)triazole |
| PubChem CID | 72866156 |
| Molecular Formula | C15H21N7 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 1-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-4-(1-methylimidazol-2-yl)triazole |
| SMILES | CCCn1nc(C)c(Cn2cc(-c3nccn3C)nn2)c1C |
| InChI | InChI=1S/C15H21N7/c1-5-7-22-12(3)13(11(2)18-22)9-21-10-14(17-19-21)15-16-6-8-20(15)4/h6,8,10H,5,7,9H2,1-4H3 |
| InChIKey | ICKVQHXDUNQWOI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-4-(1-methylimidazol-2-yl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-4-(1-methylimidazol-2-yl)triazole?
The IUPAC name of 1-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-4-(1-methylimidazol-2-yl)triazole (CID 72866156) is 1-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-4-(1-methylimidazol-2-yl)triazole.
What is the SMILES notation for 1-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-4-(1-methylimidazol-2-yl)triazole?
The canonical SMILES for 1-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-4-(1-methylimidazol-2-yl)triazole is CCCn1nc(C)c(Cn2cc(-c3nccn3C)nn2)c1C.
What is the InChIKey of 1-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-4-(1-methylimidazol-2-yl)triazole?
The InChIKey is ICKVQHXDUNQWOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N7/c1-5-7-22-12(3)13(11(2)18-22)9-21-10-14(17-19-21)15-16-6-8-20(15)4/h6,8,10H,5,7,9H2,1-4H3.
What are the key properties of 1-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-4-(1-methylimidazol-2-yl)triazole?
1-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-4-(1-methylimidazol-2-yl)triazole has a molecular weight of 299.38 g/mol, XLogP of 1.95, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-4-(1-methylimidazol-2-yl)triazole is sourced from PubChem (CID 72866156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).