C16H19N5O3S — CID 72866559
(4aS,7aR)-N-(4-imidazol-1-ylphenyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carboxamide (PubChem CID 72866559) has the molecular formula C16H19N5O3S and a molecular weight of 361.43 g/mol. Its IUPAC name is (4aS,7aR)-N-(4-imidazol-1-ylphenyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carboxamide.
| Compound Name | (4aS,7aR)-N-(4-imidazol-1-ylphenyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 72866559 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (4aS,7aR)-N-(4-imidazol-1-ylphenyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carboxamide |
| SMILES | O=C(Nc1ccc(-n2ccnc2)cc1)N1CCN[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H19N5O3S/c22-16(21-8-6-18-14-9-25(23,24)10-15(14)21)19-12-1-3-13(4-2-12)20-7-5-17-11-20/h1-5,7,11,14-15,18H,6,8-10H2,(H,19,22)/t14-,15+/m0/s1 |
| InChIKey | ULEBBFOWRHGYKL-LSDHHAIUSA-N |
| XLogP | 0.47 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |