About 2-cyclopentyl-1-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]ethanone
2-cyclopentyl-1-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]ethanone (PubChem CID 72866835) has the molecular formula C15H25NO2
and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-cyclopentyl-1-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 2-cyclopentyl-1-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]ethanone |
| PubChem CID | 72866835 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2-cyclopentyl-1-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]ethanone |
| SMILES | C[C@@H]1CN(C(=O)CC2CCCC2)C[C@@]1(O)C1CC1 |
| InChI | InChI=1S/C15H25NO2/c1-11-9-16(10-15(11,18)13-6-7-13)14(17)8-12-4-2-3-5-12/h11-13,18H,2-10H2,1H3/t11-,15+/m1/s1 |
| InChIKey | GYDPJGZMWRUCLO-ABAIWWIYSA-N |
| XLogP | 2.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopentyl-1-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-1-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]ethanone?
The IUPAC name of 2-cyclopentyl-1-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]ethanone (CID 72866835) is 2-cyclopentyl-1-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]ethanone.
What is the SMILES notation for 2-cyclopentyl-1-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]ethanone?
The canonical SMILES for 2-cyclopentyl-1-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]ethanone is C[C@@H]1CN(C(=O)CC2CCCC2)C[C@@]1(O)C1CC1.
What is the InChIKey of 2-cyclopentyl-1-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]ethanone?
The InChIKey is GYDPJGZMWRUCLO-ABAIWWIYSA-N. The full InChI is InChI=1S/C15H25NO2/c1-11-9-16(10-15(11,18)13-6-7-13)14(17)8-12-4-2-3-5-12/h11-13,18H,2-10H2,1H3/t11-,15+/m1/s1.
What are the key properties of 2-cyclopentyl-1-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]ethanone?
2-cyclopentyl-1-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]ethanone has a molecular weight of 251.37 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-1-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]ethanone is sourced from PubChem (CID 72866835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).