C16H23N5O3 — CID 72867018
2-methyl-5-[4-[2-(2-oxopiperidin-1-yl)acetyl]piperazin-1-yl]pyridazin-3-one (PubChem CID 72867018) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-methyl-5-[4-[2-(2-oxopiperidin-1-yl)acetyl]piperazin-1-yl]pyridazin-3-one.
| Compound Name | 2-methyl-5-[4-[2-(2-oxopiperidin-1-yl)acetyl]piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 72867018 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-methyl-5-[4-[2-(2-oxopiperidin-1-yl)acetyl]piperazin-1-yl]pyridazin-3-one |
| SMILES | Cn1ncc(N2CCN(C(=O)CN3CCCCC3=O)CC2)cc1=O |
| InChI | InChI=1S/C16H23N5O3/c1-18-15(23)10-13(11-17-18)19-6-8-20(9-7-19)16(24)12-21-5-3-2-4-14(21)22/h10-11H,2-9,12H2,1H3 |
| InChIKey | HHYFPEKNMDIUQT-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |