C13H21N5O3S — CID 72867402
(4aR,8aR)-2-(2-aminopyrimidin-4-yl)-7-methylsulfonyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-4a-ol (PubChem CID 72867402) has the molecular formula C13H21N5O3S and a molecular weight of 327.41 g/mol. Its IUPAC name is (4aR,8aR)-2-(2-aminopyrimidin-4-yl)-7-methylsulfonyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-4a-ol.
| Compound Name | (4aR,8aR)-2-(2-aminopyrimidin-4-yl)-7-methylsulfonyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-4a-ol |
|---|---|
| PubChem CID | 72867402 |
| Molecular Formula | C13H21N5O3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (4aR,8aR)-2-(2-aminopyrimidin-4-yl)-7-methylsulfonyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-4a-ol |
| SMILES | CS(=O)(=O)N1CC[C@]2(O)CCN(c3ccnc(N)n3)C[C@@H]2C1 |
| InChI | InChI=1S/C13H21N5O3S/c1-22(20,21)18-7-4-13(19)3-6-17(8-10(13)9-18)11-2-5-15-12(14)16-11/h2,5,10,19H,3-4,6-9H2,1H3,(H2,14,15,16)/t10-,13-/m1/s1 |
| InChIKey | GFWWNEZIVBRGFN-ZWNOBZJWSA-N |
| XLogP | -0.72 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |