About 4-[3-[4-(1-methylimidazol-2-yl)triazol-1-yl]propyl]-1,3-thiazol-2-amine
4-[3-[4-(1-methylimidazol-2-yl)triazol-1-yl]propyl]-1,3-thiazol-2-amine (PubChem CID 72867929) has the molecular formula C12H15N7S
and a molecular weight of 289.37 g/mol. Its IUPAC name is 4-[3-[4-(1-methylimidazol-2-yl)triazol-1-yl]propyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-[3-[4-(1-methylimidazol-2-yl)triazol-1-yl]propyl]-1,3-thiazol-2-amine |
| PubChem CID | 72867929 |
| Molecular Formula | C12H15N7S |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-[3-[4-(1-methylimidazol-2-yl)triazol-1-yl]propyl]-1,3-thiazol-2-amine |
| SMILES | Cn1ccnc1-c1cn(CCCc2csc(N)n2)nn1 |
| InChI | InChI=1S/C12H15N7S/c1-18-6-4-14-11(18)10-7-19(17-16-10)5-2-3-9-8-20-12(13)15-9/h4,6-8H,2-3,5H2,1H3,(H2,13,15) |
| InChIKey | HEJTXWFECIJXTH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[3-[4-(1-methylimidazol-2-yl)triazol-1-yl]propyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[4-(1-methylimidazol-2-yl)triazol-1-yl]propyl]-1,3-thiazol-2-amine?
The IUPAC name of 4-[3-[4-(1-methylimidazol-2-yl)triazol-1-yl]propyl]-1,3-thiazol-2-amine (CID 72867929) is 4-[3-[4-(1-methylimidazol-2-yl)triazol-1-yl]propyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 4-[3-[4-(1-methylimidazol-2-yl)triazol-1-yl]propyl]-1,3-thiazol-2-amine?
The canonical SMILES for 4-[3-[4-(1-methylimidazol-2-yl)triazol-1-yl]propyl]-1,3-thiazol-2-amine is Cn1ccnc1-c1cn(CCCc2csc(N)n2)nn1.
What is the InChIKey of 4-[3-[4-(1-methylimidazol-2-yl)triazol-1-yl]propyl]-1,3-thiazol-2-amine?
The InChIKey is HEJTXWFECIJXTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N7S/c1-18-6-4-14-11(18)10-7-19(17-16-10)5-2-3-9-8-20-12(13)15-9/h4,6-8H,2-3,5H2,1H3,(H2,13,15).
What are the key properties of 4-[3-[4-(1-methylimidazol-2-yl)triazol-1-yl]propyl]-1,3-thiazol-2-amine?
4-[3-[4-(1-methylimidazol-2-yl)triazol-1-yl]propyl]-1,3-thiazol-2-amine has a molecular weight of 289.37 g/mol, XLogP of 1.35, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[4-(1-methylimidazol-2-yl)triazol-1-yl]propyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 72867929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).