About 2-(2-fluoro-6-propan-2-yloxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid
2-(2-fluoro-6-propan-2-yloxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid (PubChem CID 72868277) has the molecular formula C17H25FN2O3
and a molecular weight of 324.40 g/mol. Its IUPAC name is 2-(2-fluoro-6-propan-2-yloxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(2-fluoro-6-propan-2-yloxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid |
| PubChem CID | 72868277 |
| Molecular Formula | C17H25FN2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-(2-fluoro-6-propan-2-yloxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid |
| SMILES | CC(C)Oc1cccc(F)c1C(C(=O)O)N1CCCN(C)CC1 |
| InChI | InChI=1S/C17H25FN2O3/c1-12(2)23-14-7-4-6-13(18)15(14)16(17(21)22)20-9-5-8-19(3)10-11-20/h4,6-7,12,16H,5,8-11H2,1-3H3,(H,21,22) |
| InChIKey | MBYADTFKMJDILZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-fluoro-6-propan-2-yloxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoro-6-propan-2-yloxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid?
The IUPAC name of 2-(2-fluoro-6-propan-2-yloxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid (CID 72868277) is 2-(2-fluoro-6-propan-2-yloxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid.
What is the SMILES notation for 2-(2-fluoro-6-propan-2-yloxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid?
The canonical SMILES for 2-(2-fluoro-6-propan-2-yloxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid is CC(C)Oc1cccc(F)c1C(C(=O)O)N1CCCN(C)CC1.
What is the InChIKey of 2-(2-fluoro-6-propan-2-yloxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid?
The InChIKey is MBYADTFKMJDILZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25FN2O3/c1-12(2)23-14-7-4-6-13(18)15(14)16(17(21)22)20-9-5-8-19(3)10-11-20/h4,6-7,12,16H,5,8-11H2,1-3H3,(H,21,22).
What are the key properties of 2-(2-fluoro-6-propan-2-yloxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid?
2-(2-fluoro-6-propan-2-yloxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid has a molecular weight of 324.40 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoro-6-propan-2-yloxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid is sourced from PubChem (CID 72868277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).