About [4-[(1S,2S)-2-hydroxycyclohexyl]piperazin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone
[4-[(1S,2S)-2-hydroxycyclohexyl]piperazin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone (PubChem CID 72868463) has the molecular formula C18H30N4O2
and a molecular weight of 334.46 g/mol. Its IUPAC name is [4-[(1S,2S)-2-hydroxycyclohexyl]piperazin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone.
Molecular Properties
| Compound Name | [4-[(1S,2S)-2-hydroxycyclohexyl]piperazin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone |
| PubChem CID | 72868463 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | [4-[(1S,2S)-2-hydroxycyclohexyl]piperazin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone |
| SMILES | CCCn1ncc(C(=O)N2CCN([C@H]3CCCC[C@@H]3O)CC2)c1C |
| InChI | InChI=1S/C18H30N4O2/c1-3-8-22-14(2)15(13-19-22)18(24)21-11-9-20(10-12-21)16-6-4-5-7-17(16)23/h13,16-17,23H,3-12H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | ADAHLBHPAVVNPE-IRXDYDNUSA-N |
| XLogP | 1.66 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[(1S,2S)-2-hydroxycyclohexyl]piperazin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(1S,2S)-2-hydroxycyclohexyl]piperazin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone?
The IUPAC name of [4-[(1S,2S)-2-hydroxycyclohexyl]piperazin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone (CID 72868463) is [4-[(1S,2S)-2-hydroxycyclohexyl]piperazin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone.
What is the SMILES notation for [4-[(1S,2S)-2-hydroxycyclohexyl]piperazin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone?
The canonical SMILES for [4-[(1S,2S)-2-hydroxycyclohexyl]piperazin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone is CCCn1ncc(C(=O)N2CCN([C@H]3CCCC[C@@H]3O)CC2)c1C.
What is the InChIKey of [4-[(1S,2S)-2-hydroxycyclohexyl]piperazin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone?
The InChIKey is ADAHLBHPAVVNPE-IRXDYDNUSA-N. The full InChI is InChI=1S/C18H30N4O2/c1-3-8-22-14(2)15(13-19-22)18(24)21-11-9-20(10-12-21)16-6-4-5-7-17(16)23/h13,16-17,23H,3-12H2,1-2H3/t16-,17-/m0/s1.
What are the key properties of [4-[(1S,2S)-2-hydroxycyclohexyl]piperazin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone?
[4-[(1S,2S)-2-hydroxycyclohexyl]piperazin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone has a molecular weight of 334.46 g/mol, XLogP of 1.66, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(1S,2S)-2-hydroxycyclohexyl]piperazin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone is sourced from PubChem (CID 72868463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).