C18H25N3O — CID 72869391
(3R,4S)-1-[(1-benzylimidazol-2-yl)methyl]-3,4-dimethylpiperidin-4-ol (PubChem CID 72869391) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is (3R,4S)-1-[(1-benzylimidazol-2-yl)methyl]-3,4-dimethylpiperidin-4-ol.
| Compound Name | (3R,4S)-1-[(1-benzylimidazol-2-yl)methyl]-3,4-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 72869391 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | (3R,4S)-1-[(1-benzylimidazol-2-yl)methyl]-3,4-dimethylpiperidin-4-ol |
| SMILES | C[C@@H]1CN(Cc2nccn2Cc2ccccc2)CC[C@]1(C)O |
| InChI | InChI=1S/C18H25N3O/c1-15-12-20(10-8-18(15,2)22)14-17-19-9-11-21(17)13-16-6-4-3-5-7-16/h3-7,9,11,15,22H,8,10,12-14H2,1-2H3/t15-,18+/m1/s1 |
| InChIKey | QCHRPMSNVPRCJI-QAPCUYQASA-N |
| XLogP | 2.52 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |