About (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid
(2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid (PubChem CID 728696) has the molecular formula C14H11Cl2NO4
and a molecular weight of 328.15 g/mol. Its IUPAC name is (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid |
| PubChem CID | 728696 |
| Molecular Formula | C14H11Cl2NO4 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid |
| SMILES | C[C@@H](Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C14H11Cl2NO4/c1-8(14(18)19)20-10-2-4-11(5-3-10)21-13-12(16)6-9(15)7-17-13/h2-8H,1H3,(H,18,19)/t8-/m1/s1 |
| InChIKey | SVGBNTOHFITEDI-MRVPVSSYSA-N |
| XLogP | 4.03 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid?
The IUPAC name of (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid (CID 728696) is (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid.
What is the SMILES notation for (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid?
The canonical SMILES for (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid is C[C@@H](Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1)C(=O)O.
What is the InChIKey of (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid?
The InChIKey is SVGBNTOHFITEDI-MRVPVSSYSA-N. The full InChI is InChI=1S/C14H11Cl2NO4/c1-8(14(18)19)20-10-2-4-11(5-3-10)21-13-12(16)6-9(15)7-17-13/h2-8H,1H3,(H,18,19)/t8-/m1/s1.
What are the key properties of (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid?
(2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid has a molecular weight of 328.15 g/mol, XLogP of 4.03, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid is sourced from PubChem (CID 728696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).