C19H27N5O3 — CID 72869617
2-[2-(4-cyclopentyl-3-oxopiperazin-1-yl)-2-oxoethyl]-5-pyrrolidin-1-ylpyridazin-3-one (PubChem CID 72869617) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-[2-(4-cyclopentyl-3-oxopiperazin-1-yl)-2-oxoethyl]-5-pyrrolidin-1-ylpyridazin-3-one.
| Compound Name | 2-[2-(4-cyclopentyl-3-oxopiperazin-1-yl)-2-oxoethyl]-5-pyrrolidin-1-ylpyridazin-3-one |
|---|---|
| PubChem CID | 72869617 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 2-[2-(4-cyclopentyl-3-oxopiperazin-1-yl)-2-oxoethyl]-5-pyrrolidin-1-ylpyridazin-3-one |
| SMILES | O=C(Cn1ncc(N2CCCC2)cc1=O)N1CCN(C2CCCC2)C(=O)C1 |
| InChI | InChI=1S/C19H27N5O3/c25-17-11-16(21-7-3-4-8-21)12-20-24(17)14-18(26)22-9-10-23(19(27)13-22)15-5-1-2-6-15/h11-12,15H,1-10,13-14H2 |
| InChIKey | UDHAZVUNVWXSHG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |