About 4-(azepan-1-yl)-5,7-dimethylpyrido[2,3-d]pyrimidine
4-(azepan-1-yl)-5,7-dimethylpyrido[2,3-d]pyrimidine (PubChem CID 72870631) has the molecular formula C15H20N4
and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-(azepan-1-yl)-5,7-dimethylpyrido[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(azepan-1-yl)-5,7-dimethylpyrido[2,3-d]pyrimidine |
| PubChem CID | 72870631 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 4-(azepan-1-yl)-5,7-dimethylpyrido[2,3-d]pyrimidine |
| SMILES | Cc1cc(C)c2c(N3CCCCCC3)ncnc2n1 |
| InChI | InChI=1S/C15H20N4/c1-11-9-12(2)18-14-13(11)15(17-10-16-14)19-7-5-3-4-6-8-19/h9-10H,3-8H2,1-2H3 |
| InChIKey | MSOKZDPAZXPVKA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(azepan-1-yl)-5,7-dimethylpyrido[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azepan-1-yl)-5,7-dimethylpyrido[2,3-d]pyrimidine?
The IUPAC name of 4-(azepan-1-yl)-5,7-dimethylpyrido[2,3-d]pyrimidine (CID 72870631) is 4-(azepan-1-yl)-5,7-dimethylpyrido[2,3-d]pyrimidine.
What is the SMILES notation for 4-(azepan-1-yl)-5,7-dimethylpyrido[2,3-d]pyrimidine?
The canonical SMILES for 4-(azepan-1-yl)-5,7-dimethylpyrido[2,3-d]pyrimidine is Cc1cc(C)c2c(N3CCCCCC3)ncnc2n1.
What is the InChIKey of 4-(azepan-1-yl)-5,7-dimethylpyrido[2,3-d]pyrimidine?
The InChIKey is MSOKZDPAZXPVKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4/c1-11-9-12(2)18-14-13(11)15(17-10-16-14)19-7-5-3-4-6-8-19/h9-10H,3-8H2,1-2H3.
What are the key properties of 4-(azepan-1-yl)-5,7-dimethylpyrido[2,3-d]pyrimidine?
4-(azepan-1-yl)-5,7-dimethylpyrido[2,3-d]pyrimidine has a molecular weight of 256.35 g/mol, XLogP of 3.02, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azepan-1-yl)-5,7-dimethylpyrido[2,3-d]pyrimidine is sourced from PubChem (CID 72870631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).