About (1S,3R)-7-[4-(trifluoromethyl)pyrimidin-2-yl]-7-azaspiro[3.5]nonane-1,3-diol
(1S,3R)-7-[4-(trifluoromethyl)pyrimidin-2-yl]-7-azaspiro[3.5]nonane-1,3-diol (PubChem CID 72870644) has the molecular formula C13H16F3N3O2
and a molecular weight of 303.28 g/mol. Its IUPAC name is (1S,3R)-7-[4-(trifluoromethyl)pyrimidin-2-yl]-7-azaspiro[3.5]nonane-1,3-diol.
Molecular Properties
| Compound Name | (1S,3R)-7-[4-(trifluoromethyl)pyrimidin-2-yl]-7-azaspiro[3.5]nonane-1,3-diol |
| PubChem CID | 72870644 |
| Molecular Formula | C13H16F3N3O2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (1S,3R)-7-[4-(trifluoromethyl)pyrimidin-2-yl]-7-azaspiro[3.5]nonane-1,3-diol |
| SMILES | O[C@@H]1C[C@H](O)C12CCN(c1nccc(C(F)(F)F)n1)CC2 |
| InChI | InChI=1S/C13H16F3N3O2/c14-13(15,16)8-1-4-17-11(18-8)19-5-2-12(3-6-19)9(20)7-10(12)21/h1,4,9-10,20-21H,2-3,5-7H2/t9-,10+ |
| InChIKey | AMYVKJHVGGFFEM-AOOOYVTPSA-N |
| XLogP | 1.21 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1S,3R)-7-[4-(trifluoromethyl)pyrimidin-2-yl]-7-azaspiro[3.5]nonane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,3R)-7-[4-(trifluoromethyl)pyrimidin-2-yl]-7-azaspiro[3.5]nonane-1,3-diol?
The IUPAC name of (1S,3R)-7-[4-(trifluoromethyl)pyrimidin-2-yl]-7-azaspiro[3.5]nonane-1,3-diol (CID 72870644) is (1S,3R)-7-[4-(trifluoromethyl)pyrimidin-2-yl]-7-azaspiro[3.5]nonane-1,3-diol.
What is the SMILES notation for (1S,3R)-7-[4-(trifluoromethyl)pyrimidin-2-yl]-7-azaspiro[3.5]nonane-1,3-diol?
The canonical SMILES for (1S,3R)-7-[4-(trifluoromethyl)pyrimidin-2-yl]-7-azaspiro[3.5]nonane-1,3-diol is O[C@@H]1C[C@H](O)C12CCN(c1nccc(C(F)(F)F)n1)CC2.
What is the InChIKey of (1S,3R)-7-[4-(trifluoromethyl)pyrimidin-2-yl]-7-azaspiro[3.5]nonane-1,3-diol?
The InChIKey is AMYVKJHVGGFFEM-AOOOYVTPSA-N. The full InChI is InChI=1S/C13H16F3N3O2/c14-13(15,16)8-1-4-17-11(18-8)19-5-2-12(3-6-19)9(20)7-10(12)21/h1,4,9-10,20-21H,2-3,5-7H2/t9-,10+.
What are the key properties of (1S,3R)-7-[4-(trifluoromethyl)pyrimidin-2-yl]-7-azaspiro[3.5]nonane-1,3-diol?
(1S,3R)-7-[4-(trifluoromethyl)pyrimidin-2-yl]-7-azaspiro[3.5]nonane-1,3-diol has a molecular weight of 303.28 g/mol, XLogP of 1.21, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,3R)-7-[4-(trifluoromethyl)pyrimidin-2-yl]-7-azaspiro[3.5]nonane-1,3-diol is sourced from PubChem (CID 72870644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).