C23H30N2O2 — CID 72870679
2-(cyclopropylmethyl)-9-(4-prop-2-enylbenzoyl)-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 72870679) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-9-(4-prop-2-enylbenzoyl)-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 2-(cyclopropylmethyl)-9-(4-prop-2-enylbenzoyl)-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 72870679 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-(cyclopropylmethyl)-9-(4-prop-2-enylbenzoyl)-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | C=CCc1ccc(C(=O)N2CCC3(CCC(=O)N(CC4CC4)C3)CC2)cc1 |
| InChI | InChI=1S/C23H30N2O2/c1-2-3-18-6-8-20(9-7-18)22(27)24-14-12-23(13-15-24)11-10-21(26)25(17-23)16-19-4-5-19/h2,6-9,19H,1,3-5,10-17H2 |
| InChIKey | ZXYIPARBJCRNRX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|