C18H25N5O2S — CID 72870955
N,N-dimethyl-2-[(3-thiophen-2-ylpropanoylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide (PubChem CID 72870955) has the molecular formula C18H25N5O2S and a molecular weight of 375.50 g/mol. Its IUPAC name is N,N-dimethyl-2-[(3-thiophen-2-ylpropanoylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide.
| Compound Name | N,N-dimethyl-2-[(3-thiophen-2-ylpropanoylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 72870955 |
| Molecular Formula | C18H25N5O2S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N,N-dimethyl-2-[(3-thiophen-2-ylpropanoylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide |
| SMILES | CN(C)C(=O)N1CCCn2nc(CNC(=O)CCc3cccs3)cc2C1 |
| InChI | InChI=1S/C18H25N5O2S/c1-21(2)18(25)22-8-4-9-23-15(13-22)11-14(20-23)12-19-17(24)7-6-16-5-3-10-26-16/h3,5,10-11H,4,6-9,12-13H2,1-2H3,(H,19,24) |
| InChIKey | UMWKYTCYZNHJBT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |