C22H37N5O2 — CID 72871291
5-[[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]methyl]-N,N-dimethylpyrimidin-2-amine (PubChem CID 72871291) has the molecular formula C22H37N5O2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 5-[[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]methyl]-N,N-dimethylpyrimidin-2-amine.
| Compound Name | 5-[[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]methyl]-N,N-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 72871291 |
| Molecular Formula | C22H37N5O2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | 5-[[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]methyl]-N,N-dimethylpyrimidin-2-amine |
| SMILES | COC[C@@]12CC[C@@H](N3CCOCC3)C[C@H]1CCN(Cc1cnc(N(C)C)nc1)C2 |
| InChI | InChI=1S/C22H37N5O2/c1-25(2)21-23-13-18(14-24-21)15-26-7-5-19-12-20(27-8-10-29-11-9-27)4-6-22(19,16-26)17-28-3/h13-14,19-20H,4-12,15-17H2,1-3H3/t19-,20-,22+/m1/s1 |
| InChIKey | CBILMBUCAXRVPU-SJBKTWHCSA-N |
| XLogP | 1.88 |
| TPSA | 53.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |