About (E)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylprop-2-en-1-one
(E)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylprop-2-en-1-one (PubChem CID 728718) has the molecular formula C18H17NO
and a molecular weight of 263.34 g/mol. Its IUPAC name is (E)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylprop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylprop-2-en-1-one |
| PubChem CID | 728718 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (E)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C18H17NO/c20-18(13-12-15-7-2-1-3-8-15)19-14-6-10-16-9-4-5-11-17(16)19/h1-5,7-9,11-13H,6,10,14H2/b13-12+ |
| InChIKey | SFOVHKYYGVAXCU-OUKQBFOZSA-N |
| XLogP | 3.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylprop-2-en-1-one?
The IUPAC name of (E)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylprop-2-en-1-one (CID 728718) is (E)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylprop-2-en-1-one.
What is the SMILES notation for (E)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylprop-2-en-1-one?
The canonical SMILES for (E)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylprop-2-en-1-one is O=C(/C=C/c1ccccc1)N1CCCc2ccccc21.
What is the InChIKey of (E)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylprop-2-en-1-one?
The InChIKey is SFOVHKYYGVAXCU-OUKQBFOZSA-N. The full InChI is InChI=1S/C18H17NO/c20-18(13-12-15-7-2-1-3-8-15)19-14-6-10-16-9-4-5-11-17(16)19/h1-5,7-9,11-13H,6,10,14H2/b13-12+.
What are the key properties of (E)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylprop-2-en-1-one?
(E)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylprop-2-en-1-one has a molecular weight of 263.34 g/mol, XLogP of 3.68, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenylprop-2-en-1-one is sourced from PubChem (CID 728718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).