C14H22F4N2O — CID 72871935
2-ethyl-8-(3,3,4,4-tetrafluorobutyl)-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 72871935) has the molecular formula C14H22F4N2O and a molecular weight of 310.34 g/mol. Its IUPAC name is 2-ethyl-8-(3,3,4,4-tetrafluorobutyl)-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 2-ethyl-8-(3,3,4,4-tetrafluorobutyl)-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 72871935 |
| Molecular Formula | C14H22F4N2O |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-ethyl-8-(3,3,4,4-tetrafluorobutyl)-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | CCN1CC2(CCN(CCC(F)(F)C(F)F)CC2)CC1=O |
| InChI | InChI=1S/C14H22F4N2O/c1-2-20-10-13(9-11(20)21)3-6-19(7-4-13)8-5-14(17,18)12(15)16/h12H,2-10H2,1H3 |
| InChIKey | UNFRPRHQXQXWKD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|