C19H25N3O4 — CID 72872661
(3aR,6aR)-5-[3-(2-methyl-6-oxo-1-pyridinyl)propanoyl]-2-prop-2-enyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72872661) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is (3aR,6aR)-5-[3-(2-methyl-6-oxo-1-pyridinyl)propanoyl]-2-prop-2-enyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-[3-(2-methyl-6-oxo-1-pyridinyl)propanoyl]-2-prop-2-enyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72872661 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (3aR,6aR)-5-[3-(2-methyl-6-oxo-1-pyridinyl)propanoyl]-2-prop-2-enyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | C=CCN1C[C@@H]2CN(C(=O)CCn3c(C)cccc3=O)C[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C19H25N3O4/c1-3-8-20-10-15-11-21(13-19(15,12-20)18(25)26)16(23)7-9-22-14(2)5-4-6-17(22)24/h3-6,15H,1,7-13H2,2H3,(H,25,26)/t15-,19-/m1/s1 |
| InChIKey | BUBYPDYTHJPICD-DNVCBOLYSA-N |
| XLogP | 0.58 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|