C12H20N4S — CID 72872800
5-methyl-4-[4-(methylsulfanylmethyl)piperidin-1-yl]pyrimidin-2-amine (PubChem CID 72872800) has the molecular formula C12H20N4S and a molecular weight of 252.39 g/mol. Its IUPAC name is 5-methyl-4-[4-(methylsulfanylmethyl)piperidin-1-yl]pyrimidin-2-amine.
| Compound Name | 5-methyl-4-[4-(methylsulfanylmethyl)piperidin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 72872800 |
| Molecular Formula | C12H20N4S |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 5-methyl-4-[4-(methylsulfanylmethyl)piperidin-1-yl]pyrimidin-2-amine |
| SMILES | CSCC1CCN(c2nc(N)ncc2C)CC1 |
| InChI | InChI=1S/C12H20N4S/c1-9-7-14-12(13)15-11(9)16-5-3-10(4-6-16)8-17-2/h7,10H,3-6,8H2,1-2H3,(H2,13,14,15) |
| InChIKey | HAAIUPKIKVDUMM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |