About N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-2-(1-propan-2-ylpiperidin-4-yl)acetamide
N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-2-(1-propan-2-ylpiperidin-4-yl)acetamide (PubChem CID 72872954) has the molecular formula C16H29N5O
and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-2-(1-propan-2-ylpiperidin-4-yl)acetamide.
Molecular Properties
| Compound Name | N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-2-(1-propan-2-ylpiperidin-4-yl)acetamide |
| PubChem CID | 72872954 |
| Molecular Formula | C16H29N5O |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.24 |
| IUPAC Name | N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-2-(1-propan-2-ylpiperidin-4-yl)acetamide |
| SMILES | CCn1ncnc1C(C)NC(=O)CC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C16H29N5O/c1-5-21-16(17-11-18-21)13(4)19-15(22)10-14-6-8-20(9-7-14)12(2)3/h11-14H,5-10H2,1-4H3,(H,19,22) |
| InChIKey | ZHKHBFDVHYXWNO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-2-(1-propan-2-ylpiperidin-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-2-(1-propan-2-ylpiperidin-4-yl)acetamide?
The IUPAC name of N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-2-(1-propan-2-ylpiperidin-4-yl)acetamide (CID 72872954) is N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-2-(1-propan-2-ylpiperidin-4-yl)acetamide.
What is the SMILES notation for N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-2-(1-propan-2-ylpiperidin-4-yl)acetamide?
The canonical SMILES for N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-2-(1-propan-2-ylpiperidin-4-yl)acetamide is CCn1ncnc1C(C)NC(=O)CC1CCN(C(C)C)CC1.
What is the InChIKey of N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-2-(1-propan-2-ylpiperidin-4-yl)acetamide?
The InChIKey is ZHKHBFDVHYXWNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N5O/c1-5-21-16(17-11-18-21)13(4)19-15(22)10-14-6-8-20(9-7-14)12(2)3/h11-14H,5-10H2,1-4H3,(H,19,22).
What are the key properties of N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-2-(1-propan-2-ylpiperidin-4-yl)acetamide?
N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-2-(1-propan-2-ylpiperidin-4-yl)acetamide has a molecular weight of 307.44 g/mol, XLogP of 1.99, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-2-(1-propan-2-ylpiperidin-4-yl)acetamide is sourced from PubChem (CID 72872954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).