C19H31N3O2S — CID 72873298
trans-(1S,3R)-1-N,3-N,3-N,1,2,2-hexamethyl-1-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]cyclopentane-1,3-dicarboxamide (PubChem CID 72873298) has the molecular formula C19H31N3O2S and a molecular weight of 365.54 g/mol. Its IUPAC name is trans-(1S,3R)-1-N,3-N,3-N,1,2,2-hexamethyl-1-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]cyclopentane-1,3-dicarboxamide.
| Compound Name | trans-(1S,3R)-1-N,3-N,3-N,1,2,2-hexamethyl-1-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]cyclopentane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 72873298 |
| Molecular Formula | C19H31N3O2S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | trans-(1S,3R)-1-N,3-N,3-N,1,2,2-hexamethyl-1-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]cyclopentane-1,3-dicarboxamide |
| SMILES | Cc1ncsc1CCN(C)C(=O)[C@@]1(C)CC[C@@H](C(=O)N(C)C)C1(C)C |
| InChI | InChI=1S/C19H31N3O2S/c1-13-15(25-12-20-13)9-11-22(7)17(24)19(4)10-8-14(18(19,2)3)16(23)21(5)6/h12,14H,8-11H2,1-7H3/t14-,19+/m0/s1 |
| InChIKey | AXWLFEUUTSQVTF-IFXJQAMLSA-N |
| XLogP | 2.98 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |