About (3R,4S)-4-cyclopropyl-N,N-dimethyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine
(3R,4S)-4-cyclopropyl-N,N-dimethyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine (PubChem CID 72873718) has the molecular formula C14H22N4
and a molecular weight of 246.36 g/mol. Its IUPAC name is (3R,4S)-4-cyclopropyl-N,N-dimethyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine.
Molecular Properties
| Compound Name | (3R,4S)-4-cyclopropyl-N,N-dimethyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine |
| PubChem CID | 72873718 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | (3R,4S)-4-cyclopropyl-N,N-dimethyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine |
| SMILES | CN(C)[C@H]1CN(Cc2ncccn2)C[C@@H]1C1CC1 |
| InChI | InChI=1S/C14H22N4/c1-17(2)13-9-18(8-12(13)11-4-5-11)10-14-15-6-3-7-16-14/h3,6-7,11-13H,4-5,8-10H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | AETHTEVTUIBJKC-OLZOCXBDSA-N |
| XLogP | 1.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R,4S)-4-cyclopropyl-N,N-dimethyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-cyclopropyl-N,N-dimethyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine?
The IUPAC name of (3R,4S)-4-cyclopropyl-N,N-dimethyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine (CID 72873718) is (3R,4S)-4-cyclopropyl-N,N-dimethyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine.
What is the SMILES notation for (3R,4S)-4-cyclopropyl-N,N-dimethyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine?
The canonical SMILES for (3R,4S)-4-cyclopropyl-N,N-dimethyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine is CN(C)[C@H]1CN(Cc2ncccn2)C[C@@H]1C1CC1.
What is the InChIKey of (3R,4S)-4-cyclopropyl-N,N-dimethyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine?
The InChIKey is AETHTEVTUIBJKC-OLZOCXBDSA-N. The full InChI is InChI=1S/C14H22N4/c1-17(2)13-9-18(8-12(13)11-4-5-11)10-14-15-6-3-7-16-14/h3,6-7,11-13H,4-5,8-10H2,1-2H3/t12-,13+/m1/s1.
What are the key properties of (3R,4S)-4-cyclopropyl-N,N-dimethyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine?
(3R,4S)-4-cyclopropyl-N,N-dimethyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine has a molecular weight of 246.36 g/mol, XLogP of 1.25, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-cyclopropyl-N,N-dimethyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine is sourced from PubChem (CID 72873718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).