About N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-(tetrazol-1-yl)propanamide
N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-(tetrazol-1-yl)propanamide (PubChem CID 72874132) has the molecular formula C15H19N5O3
and a molecular weight of 317.35 g/mol. Its IUPAC name is N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-(tetrazol-1-yl)propanamide.
Molecular Properties
| Compound Name | N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-(tetrazol-1-yl)propanamide |
| PubChem CID | 72874132 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-(tetrazol-1-yl)propanamide |
| SMILES | COc1cccc2c1OCC(CNC(=O)CCn1cnnn1)C2 |
| InChI | InChI=1S/C15H19N5O3/c1-22-13-4-2-3-12-7-11(9-23-15(12)13)8-16-14(21)5-6-20-10-17-18-19-20/h2-4,10-11H,5-9H2,1H3,(H,16,21) |
| InChIKey | CEWBJCQILSUBJD-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-(tetrazol-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-(tetrazol-1-yl)propanamide?
The IUPAC name of N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-(tetrazol-1-yl)propanamide (CID 72874132) is N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-(tetrazol-1-yl)propanamide.
What is the SMILES notation for N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-(tetrazol-1-yl)propanamide?
The canonical SMILES for N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-(tetrazol-1-yl)propanamide is COc1cccc2c1OCC(CNC(=O)CCn1cnnn1)C2.
What is the InChIKey of N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-(tetrazol-1-yl)propanamide?
The InChIKey is CEWBJCQILSUBJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O3/c1-22-13-4-2-3-12-7-11(9-23-15(12)13)8-16-14(21)5-6-20-10-17-18-19-20/h2-4,10-11H,5-9H2,1H3,(H,16,21).
What are the key properties of N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-(tetrazol-1-yl)propanamide?
N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-(tetrazol-1-yl)propanamide has a molecular weight of 317.35 g/mol, XLogP of 0.44, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-(tetrazol-1-yl)propanamide is sourced from PubChem (CID 72874132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).