C18H32N4O — CID 72874438
1-[3-[1-[3-(dimethylamino)propyl]imidazol-2-yl]piperidin-1-yl]-3-methylbutan-1-one (PubChem CID 72874438) has the molecular formula C18H32N4O and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-[3-[1-[3-(dimethylamino)propyl]imidazol-2-yl]piperidin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[3-[1-[3-(dimethylamino)propyl]imidazol-2-yl]piperidin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 72874438 |
| Molecular Formula | C18H32N4O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | 1-[3-[1-[3-(dimethylamino)propyl]imidazol-2-yl]piperidin-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CCCC(c2nccn2CCCN(C)C)C1 |
| InChI | InChI=1S/C18H32N4O/c1-15(2)13-17(23)22-10-5-7-16(14-22)18-19-8-12-21(18)11-6-9-20(3)4/h8,12,15-16H,5-7,9-11,13-14H2,1-4H3 |
| InChIKey | AASSCEKKIRRESX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |