C16H20ClN3OS — CID 72874443
(5-chlorothiophen-2-yl)-[4-(1-propan-2-ylimidazol-2-yl)piperidin-1-yl]methanone (PubChem CID 72874443) has the molecular formula C16H20ClN3OS and a molecular weight of 337.88 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-[4-(1-propan-2-ylimidazol-2-yl)piperidin-1-yl]methanone.
| Compound Name | (5-chlorothiophen-2-yl)-[4-(1-propan-2-ylimidazol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 72874443 |
| Molecular Formula | C16H20ClN3OS |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (5-chlorothiophen-2-yl)-[4-(1-propan-2-ylimidazol-2-yl)piperidin-1-yl]methanone |
| SMILES | CC(C)n1ccnc1C1CCN(C(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C16H20ClN3OS/c1-11(2)20-10-7-18-15(20)12-5-8-19(9-6-12)16(21)13-3-4-14(17)22-13/h3-4,7,10-12H,5-6,8-9H2,1-2H3 |
| InChIKey | AROYSDLLDCEMDJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |