C18H28N6S — CID 72874958
4-[4-cyclopropyl-5-(imidazol-1-ylmethyl)-1,2,4-triazol-3-yl]-1-(3-methylsulfanylpropyl)piperidine (PubChem CID 72874958) has the molecular formula C18H28N6S and a molecular weight of 360.53 g/mol. Its IUPAC name is 4-[4-cyclopropyl-5-(imidazol-1-ylmethyl)-1,2,4-triazol-3-yl]-1-(3-methylsulfanylpropyl)piperidine.
| Compound Name | 4-[4-cyclopropyl-5-(imidazol-1-ylmethyl)-1,2,4-triazol-3-yl]-1-(3-methylsulfanylpropyl)piperidine |
|---|---|
| PubChem CID | 72874958 |
| Molecular Formula | C18H28N6S |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 4-[4-cyclopropyl-5-(imidazol-1-ylmethyl)-1,2,4-triazol-3-yl]-1-(3-methylsulfanylpropyl)piperidine |
| SMILES | CSCCCN1CCC(c2nnc(Cn3ccnc3)n2C2CC2)CC1 |
| InChI | InChI=1S/C18H28N6S/c1-25-12-2-8-22-9-5-15(6-10-22)18-21-20-17(24(18)16-3-4-16)13-23-11-7-19-14-23/h7,11,14-16H,2-6,8-10,12-13H2,1H3 |
| InChIKey | GUNGGCBVOVHCKV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|