C16H21F3N4O — CID 72875365
4-[2-[5-cyclopentyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]ethyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 72875365) has the molecular formula C16H21F3N4O and a molecular weight of 342.37 g/mol. Its IUPAC name is 4-[2-[5-cyclopentyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]ethyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[2-[5-cyclopentyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]ethyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 72875365 |
| Molecular Formula | C16H21F3N4O |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 4-[2-[5-cyclopentyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]ethyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1CCc1nc(C2CCCC2)nn1CC(F)(F)F |
| InChI | InChI=1S/C16H21F3N4O/c1-10-13(11(2)24-22-10)7-8-14-20-15(12-5-3-4-6-12)21-23(14)9-16(17,18)19/h12H,3-9H2,1-2H3 |
| InChIKey | FBCVUWCPIDHZCP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |