About 3-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-6-phenyl-1H-pyridin-2-one
3-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-6-phenyl-1H-pyridin-2-one (PubChem CID 72875935) has the molecular formula C22H22N4O2
and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-6-phenyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-6-phenyl-1H-pyridin-2-one |
| PubChem CID | 72875935 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 3-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-6-phenyl-1H-pyridin-2-one |
| SMILES | CC(C)(C)c1ncc2c(n1)CN(C(=O)c1ccc(-c3ccccc3)[nH]c1=O)C2 |
| InChI | InChI=1S/C22H22N4O2/c1-22(2,3)21-23-11-15-12-26(13-18(15)25-21)20(28)16-9-10-17(24-19(16)27)14-7-5-4-6-8-14/h4-11H,12-13H2,1-3H3,(H,24,27) |
| InChIKey | VOYOGHFTIHYYIW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-6-phenyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-6-phenyl-1H-pyridin-2-one?
The IUPAC name of 3-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-6-phenyl-1H-pyridin-2-one (CID 72875935) is 3-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-6-phenyl-1H-pyridin-2-one.
What is the SMILES notation for 3-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-6-phenyl-1H-pyridin-2-one?
The canonical SMILES for 3-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-6-phenyl-1H-pyridin-2-one is CC(C)(C)c1ncc2c(n1)CN(C(=O)c1ccc(-c3ccccc3)[nH]c1=O)C2.
What is the InChIKey of 3-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-6-phenyl-1H-pyridin-2-one?
The InChIKey is VOYOGHFTIHYYIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O2/c1-22(2,3)21-23-11-15-12-26(13-18(15)25-21)20(28)16-9-10-17(24-19(16)27)14-7-5-4-6-8-14/h4-11H,12-13H2,1-3H3,(H,24,27).
What are the key properties of 3-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-6-phenyl-1H-pyridin-2-one?
3-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-6-phenyl-1H-pyridin-2-one has a molecular weight of 374.44 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-6-phenyl-1H-pyridin-2-one is sourced from PubChem (CID 72875935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).