About N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-2-(ethylamino)pyrimidine-5-carboxamide
N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-2-(ethylamino)pyrimidine-5-carboxamide (PubChem CID 72876149) has the molecular formula C17H20N4O2
and a molecular weight of 312.37 g/mol. Its IUPAC name is N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-2-(ethylamino)pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-2-(ethylamino)pyrimidine-5-carboxamide |
| PubChem CID | 72876149 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-2-(ethylamino)pyrimidine-5-carboxamide |
| SMILES | CCNc1ncc(C(=O)NCC2OCCc3ccccc32)cn1 |
| InChI | InChI=1S/C17H20N4O2/c1-2-18-17-20-9-13(10-21-17)16(22)19-11-15-14-6-4-3-5-12(14)7-8-23-15/h3-6,9-10,15H,2,7-8,11H2,1H3,(H,19,22)(H,18,20,21) |
| InChIKey | FTVOEXXMLIJPKY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-2-(ethylamino)pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-2-(ethylamino)pyrimidine-5-carboxamide?
The IUPAC name of N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-2-(ethylamino)pyrimidine-5-carboxamide (CID 72876149) is N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-2-(ethylamino)pyrimidine-5-carboxamide.
What is the SMILES notation for N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-2-(ethylamino)pyrimidine-5-carboxamide?
The canonical SMILES for N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-2-(ethylamino)pyrimidine-5-carboxamide is CCNc1ncc(C(=O)NCC2OCCc3ccccc32)cn1.
What is the InChIKey of N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-2-(ethylamino)pyrimidine-5-carboxamide?
The InChIKey is FTVOEXXMLIJPKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O2/c1-2-18-17-20-9-13(10-21-17)16(22)19-11-15-14-6-4-3-5-12(14)7-8-23-15/h3-6,9-10,15H,2,7-8,11H2,1H3,(H,19,22)(H,18,20,21).
What are the key properties of N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-2-(ethylamino)pyrimidine-5-carboxamide?
N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-2-(ethylamino)pyrimidine-5-carboxamide has a molecular weight of 312.37 g/mol, XLogP of 1.95, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dihydro-1H-isochromen-1-ylmethyl)-2-(ethylamino)pyrimidine-5-carboxamide is sourced from PubChem (CID 72876149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).