C16H23N3O — CID 72876301
[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone (PubChem CID 72876301) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is [(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone.
| Compound Name | [(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 72876301 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | [(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone |
| SMILES | CCCn1ncc(C(=O)N2C[C@H]3CC=CC[C@H]3C2)c1C |
| InChI | InChI=1S/C16H23N3O/c1-3-8-19-12(2)15(9-17-19)16(20)18-10-13-6-4-5-7-14(13)11-18/h4-5,9,13-14H,3,6-8,10-11H2,1-2H3/t13-,14+ |
| InChIKey | CKRNXFXYNFDYCK-OKILXGFUSA-N |
| XLogP | 2.64 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|