C20H35N3O — CID 72877473
4-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methyl-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 72877473) has the molecular formula C20H35N3O and a molecular weight of 333.52 g/mol. Its IUPAC name is 4-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methyl-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | 4-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 72877473 |
| Molecular Formula | C20H35N3O |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | 4-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | CC(C)=CCC/C(C)=C/CN1CCN(C)C2(CCNC(=O)CC2)C1 |
| InChI | InChI=1S/C20H35N3O/c1-17(2)6-5-7-18(3)9-13-23-15-14-22(4)20(16-23)10-8-19(24)21-12-11-20/h6,9H,5,7-8,10-16H2,1-4H3,(H,21,24)/b18-9+ |
| InChIKey | ZSHVUOMWGFHBRB-GIJQJNRQSA-N |
| XLogP | 2.97 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|