C20H30N2O — CID 72877829
N-[1-[(3-methylphenyl)methyl]cyclopropyl]-3-(1-methylpiperidin-2-yl)propanamide (PubChem CID 72877829) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is N-[1-[(3-methylphenyl)methyl]cyclopropyl]-3-(1-methylpiperidin-2-yl)propanamide.
| Compound Name | N-[1-[(3-methylphenyl)methyl]cyclopropyl]-3-(1-methylpiperidin-2-yl)propanamide |
|---|---|
| PubChem CID | 72877829 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | N-[1-[(3-methylphenyl)methyl]cyclopropyl]-3-(1-methylpiperidin-2-yl)propanamide |
| SMILES | Cc1cccc(CC2(NC(=O)CCC3CCCCN3C)CC2)c1 |
| InChI | InChI=1S/C20H30N2O/c1-16-6-5-7-17(14-16)15-20(11-12-20)21-19(23)10-9-18-8-3-4-13-22(18)2/h5-7,14,18H,3-4,8-13,15H2,1-2H3,(H,21,23) |
| InChIKey | OBKFVAWGEFMKSO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |