About N-[(3R,4S)-1-(4-methoxypyrimidin-2-yl)-4-propylpyrrolidin-3-yl]oxane-4-carboxamide
N-[(3R,4S)-1-(4-methoxypyrimidin-2-yl)-4-propylpyrrolidin-3-yl]oxane-4-carboxamide (PubChem CID 72878117) has the molecular formula C18H28N4O3
and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[(3R,4S)-1-(4-methoxypyrimidin-2-yl)-4-propylpyrrolidin-3-yl]oxane-4-carboxamide.
Molecular Properties
| Compound Name | N-[(3R,4S)-1-(4-methoxypyrimidin-2-yl)-4-propylpyrrolidin-3-yl]oxane-4-carboxamide |
| PubChem CID | 72878117 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-[(3R,4S)-1-(4-methoxypyrimidin-2-yl)-4-propylpyrrolidin-3-yl]oxane-4-carboxamide |
| SMILES | CCC[C@H]1CN(c2nccc(OC)n2)C[C@@H]1NC(=O)C1CCOCC1 |
| InChI | InChI=1S/C18H28N4O3/c1-3-4-14-11-22(18-19-8-5-16(21-18)24-2)12-15(14)20-17(23)13-6-9-25-10-7-13/h5,8,13-15H,3-4,6-7,9-12H2,1-2H3,(H,20,23)/t14-,15-/m0/s1 |
| InChIKey | YKBUDBRJURWSIT-GJZGRUSLSA-N |
| XLogP | 1.63 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(3R,4S)-1-(4-methoxypyrimidin-2-yl)-4-propylpyrrolidin-3-yl]oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4S)-1-(4-methoxypyrimidin-2-yl)-4-propylpyrrolidin-3-yl]oxane-4-carboxamide?
The IUPAC name of N-[(3R,4S)-1-(4-methoxypyrimidin-2-yl)-4-propylpyrrolidin-3-yl]oxane-4-carboxamide (CID 72878117) is N-[(3R,4S)-1-(4-methoxypyrimidin-2-yl)-4-propylpyrrolidin-3-yl]oxane-4-carboxamide.
What is the SMILES notation for N-[(3R,4S)-1-(4-methoxypyrimidin-2-yl)-4-propylpyrrolidin-3-yl]oxane-4-carboxamide?
The canonical SMILES for N-[(3R,4S)-1-(4-methoxypyrimidin-2-yl)-4-propylpyrrolidin-3-yl]oxane-4-carboxamide is CCC[C@H]1CN(c2nccc(OC)n2)C[C@@H]1NC(=O)C1CCOCC1.
What is the InChIKey of N-[(3R,4S)-1-(4-methoxypyrimidin-2-yl)-4-propylpyrrolidin-3-yl]oxane-4-carboxamide?
The InChIKey is YKBUDBRJURWSIT-GJZGRUSLSA-N. The full InChI is InChI=1S/C18H28N4O3/c1-3-4-14-11-22(18-19-8-5-16(21-18)24-2)12-15(14)20-17(23)13-6-9-25-10-7-13/h5,8,13-15H,3-4,6-7,9-12H2,1-2H3,(H,20,23)/t14-,15-/m0/s1.
What are the key properties of N-[(3R,4S)-1-(4-methoxypyrimidin-2-yl)-4-propylpyrrolidin-3-yl]oxane-4-carboxamide?
N-[(3R,4S)-1-(4-methoxypyrimidin-2-yl)-4-propylpyrrolidin-3-yl]oxane-4-carboxamide has a molecular weight of 348.45 g/mol, XLogP of 1.63, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4S)-1-(4-methoxypyrimidin-2-yl)-4-propylpyrrolidin-3-yl]oxane-4-carboxamide is sourced from PubChem (CID 72878117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).