C23H28F2N2O2 — CID 72878220
2-(difluoromethoxy)-N-[(1-methylpiperidin-4-yl)methyl]-N-(2-phenylethyl)benzamide (PubChem CID 72878220) has the molecular formula C23H28F2N2O2 and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[(1-methylpiperidin-4-yl)methyl]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-(difluoromethoxy)-N-[(1-methylpiperidin-4-yl)methyl]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 72878220 |
| Molecular Formula | C23H28F2N2O2 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-(difluoromethoxy)-N-[(1-methylpiperidin-4-yl)methyl]-N-(2-phenylethyl)benzamide |
| SMILES | CN1CCC(CN(CCc2ccccc2)C(=O)c2ccccc2OC(F)F)CC1 |
| InChI | InChI=1S/C23H28F2N2O2/c1-26-14-11-19(12-15-26)17-27(16-13-18-7-3-2-4-8-18)22(28)20-9-5-6-10-21(20)29-23(24)25/h2-10,19,23H,11-17H2,1H3 |
| InChIKey | UYOKXWOLNRAJAR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |